C7H11NO3 — CID 163848084
4-amino-5-(2-methylpropyl)-1,3-dioxol-2-one (PubChem CID 163848084) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-amino-5-(2-methylpropyl)-1,3-dioxol-2-one.
| Compound Name | 4-amino-5-(2-methylpropyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 163848084 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-amino-5-(2-methylpropyl)-1,3-dioxol-2-one |
| SMILES | CC(C)Cc1oc(=O)oc1N |
| InChI | InChI=1S/C7H11NO3/c1-4(2)3-5-6(8)11-7(9)10-5/h4H,3,8H2,1-2H3 |
| InChIKey | ORYAYGBKEIEEBC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |