C26H21N3O3 — CID 163848381
(3E)-3-[[4-[9H-carbazol-3-ylmethyl(methyl)amino]phenyl]methylidene]piperidine-2,4,6-trione (PubChem CID 163848381) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is (3E)-3-[[4-[9H-carbazol-3-ylmethyl(methyl)amino]phenyl]methylidene]piperidine-2,4,6-trione.
| Compound Name | (3E)-3-[[4-[9H-carbazol-3-ylmethyl(methyl)amino]phenyl]methylidene]piperidine-2,4,6-trione |
|---|---|
| PubChem CID | 163848381 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3E)-3-[[4-[9H-carbazol-3-ylmethyl(methyl)amino]phenyl]methylidene]piperidine-2,4,6-trione |
| SMILES | CN(Cc1ccc2[nH]c3ccccc3c2c1)c1ccc(/C=C2\C(=O)CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C26H21N3O3/c1-29(15-17-8-11-23-20(13-17)19-4-2-3-5-22(19)27-23)18-9-6-16(7-10-18)12-21-24(30)14-25(31)28-26(21)32/h2-13,27H,14-15H2,1H3,(H,28,31,32)/b21-12+ |
| InChIKey | OSEOHEHUFWHOSH-CIAFOILYSA-N |
| XLogP | 3.96 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|