About 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine
1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine (PubChem CID 163851119) has the molecular formula C21H25F2N3O
and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine |
| PubChem CID | 163851119 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine |
| SMILES | Fc1cc(F)cc(OCCN2CCC(NN3C[C@H]3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25F2N3O/c22-17-12-18(23)14-20(13-17)27-11-10-25-8-6-19(7-9-25)24-26-15-21(26)16-4-2-1-3-5-16/h1-5,12-14,19,21,24H,6-11,15H2/t21-,26?/m0/s1 |
| InChIKey | OUKWCSCVIHZUAS-GVNKFJBHSA-N |
| XLogP | 3.37 |
| TPSA | 27.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine?
The IUPAC name of 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine (CID 163851119) is 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine.
What is the SMILES notation for 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine?
The canonical SMILES for 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine is Fc1cc(F)cc(OCCN2CCC(NN3C[C@H]3c3ccccc3)CC2)c1.
What is the InChIKey of 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine?
The InChIKey is OUKWCSCVIHZUAS-GVNKFJBHSA-N. The full InChI is InChI=1S/C21H25F2N3O/c22-17-12-18(23)14-20(13-17)27-11-10-25-8-6-19(7-9-25)24-26-15-21(26)16-4-2-1-3-5-16/h1-5,12-14,19,21,24H,6-11,15H2/t21-,26?/m0/s1.
What are the key properties of 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine?
1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine has a molecular weight of 373.45 g/mol, XLogP of 3.37, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine is sourced from PubChem (CID 163851119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).