C21H25F2N3O — CID 163851119
1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine (PubChem CID 163851119) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 163851119 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-[(2R)-2-phenylaziridin-1-yl]piperidin-4-amine |
| SMILES | Fc1cc(F)cc(OCCN2CCC(NN3C[C@H]3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25F2N3O/c22-17-12-18(23)14-20(13-17)27-11-10-25-8-6-19(7-9-25)24-26-15-21(26)16-4-2-1-3-5-16/h1-5,12-14,19,21,24H,6-11,15H2/t21-,26?/m0/s1 |
| InChIKey | OUKWCSCVIHZUAS-GVNKFJBHSA-N |
| XLogP | 3.37 |
| TPSA | 27.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|