C25H32N2O8S — CID 163851260
3-[[(2S,3S)-1-[bis(ethenyl)amino]-3-hydroperoxy-1-oxobutan-2-yl]-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dihydroxybut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 163851260) has the molecular formula C25H32N2O8S and a molecular weight of 520.60 g/mol. Its IUPAC name is 3-[[(2S,3S)-1-[bis(ethenyl)amino]-3-hydroperoxy-1-oxobutan-2-yl]-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dihydroxybut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[(2S,3S)-1-[bis(ethenyl)amino]-3-hydroperoxy-1-oxobutan-2-yl]-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dihydroxybut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 163851260 |
| Molecular Formula | C25H32N2O8S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-[[(2S,3S)-1-[bis(ethenyl)amino]-3-hydroperoxy-1-oxobutan-2-yl]-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dihydroxybut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | C=CN(C=C)C(=O)[C@H]([C@H](C)OO)N(C(=O)C1CCC(C)CC1)c1cc(C#CC(C)(O)O)sc1C(=O)O |
| InChI | InChI=1S/C25H32N2O8S/c1-6-26(7-2)23(29)20(16(4)35-34)27(22(28)17-10-8-15(3)9-11-17)19-14-18(12-13-25(5,32)33)36-21(19)24(30)31/h6-7,14-17,20,32-34H,1-2,8-11H2,3-5H3,(H,30,31)/t15?,16-,17?,20-/m0/s1 |
| InChIKey | OUOGUBXAPGOUAH-UGZUTAHUSA-N |
| XLogP | 3.02 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|