About N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide
N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide (PubChem CID 163851621) has the molecular formula C8H12F2N2
and a molecular weight of 174.19 g/mol. Its IUPAC name is N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide.
Molecular Properties
| Compound Name | N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide |
| PubChem CID | 163851621 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide |
| SMILES | C=C(/C=C\N=C(\N)CC)C(F)F |
| InChI | InChI=1S/C8H12F2N2/c1-3-7(11)12-5-4-6(2)8(9)10/h4-5,8H,2-3H2,1H3,(H2,11,12)/b5-4- |
| InChIKey | OUVSCKBFLYURQK-PLNGDYQASA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide?
The IUPAC name of N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide (CID 163851621) is N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide.
What is the SMILES notation for N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide?
The canonical SMILES for N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide is C=C(/C=C\N=C(\N)CC)C(F)F.
What is the InChIKey of N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide?
The InChIKey is OUVSCKBFLYURQK-PLNGDYQASA-N. The full InChI is InChI=1S/C8H12F2N2/c1-3-7(11)12-5-4-6(2)8(9)10/h4-5,8H,2-3H2,1H3,(H2,11,12)/b5-4-.
What are the key properties of N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide?
N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide has a molecular weight of 174.19 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1Z)-3-(difluoromethyl)buta-1,3-dienyl]propanimidamide is sourced from PubChem (CID 163851621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).