C14H18N2 — CID 163852069
2,3,4,5,6,8-hexamethyl-1,7-naphthyridine (PubChem CID 163852069) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,3,4,5,6,8-hexamethyl-1,7-naphthyridine.
| Compound Name | 2,3,4,5,6,8-hexamethyl-1,7-naphthyridine |
|---|---|
| PubChem CID | 163852069 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2,3,4,5,6,8-hexamethyl-1,7-naphthyridine |
| SMILES | Cc1nc2c(C)nc(C)c(C)c2c(C)c1C |
| InChI | InChI=1S/C14H18N2/c1-7-8(2)13-9(3)11(5)15-12(6)14(13)16-10(7)4/h1-6H3 |
| InChIKey | XEHYPVLENLGDQG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |