C39H36I2O7 — CID 163852181
12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane;4-methoxyphenol (PubChem CID 163852181) has the molecular formula C39H36I2O7 and a molecular weight of 870.52 g/mol. Its IUPAC name is 12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane;4-methoxyphenol.
| Compound Name | 12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane;4-methoxyphenol |
|---|---|
| PubChem CID | 163852181 |
| Molecular Formula | C39H36I2O7 |
| Molecular Weight | 870.52 g/mol |
| Exact Mass | 870.06 |
| IUPAC Name | 12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane;4-methoxyphenol |
| SMILES | COC.COc1ccc(O)cc1.COc1ccc2ccc(OC)c(C3c4cc(I)cc(I)c4Oc4ccc5ccc(OC)cc5c43)c2c1 |
| InChI | InChI=1S/C30H22I2O4.C7H8O2.C2H6O/c1-33-19-8-4-16-6-10-25(35-3)27(21(16)14-19)29-23-12-18(31)13-24(32)30(23)36-26-11-7-17-5-9-20(34-2)15-22(17)28(26)29;1-9-7-4-2-6(8)3-5-7;1-3-2/h4-15,29H,1-3H3;2-5,8H,1H3;1-2H3 |
| InChIKey | OVHKAMSEGJHUDW-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.52 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|