C28H39NO3 — CID 163852511
2-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione (PubChem CID 163852511) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 2-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163852511 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 2-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/CN3C(=O)c4ccccc4C3=O)CCC[C@]12C |
| InChI | InChI=1S/C28H39NO3/c1-19(9-7-16-27(2,3)32)23-13-14-24-20(10-8-17-28(23,24)4)15-18-29-25(30)21-11-5-6-12-22(21)26(29)31/h5-6,11-12,15,19,23-24,32H,7-10,13-14,16-18H2,1-4H3/b20-15+/t19-,23-,24+,28-/m1/s1 |
| InChIKey | OVODZAXTZIYSLS-RRLPNCMISA-N |
| XLogP | 6.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|