About tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate
tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate (PubChem CID 163853893) has the molecular formula C20H24Cl2FN3O3
and a molecular weight of 444.33 g/mol. Its IUPAC name is tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate |
| PubChem CID | 163853893 |
| Molecular Formula | C20H24Cl2FN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2nn(Cc3ccc(Cl)cc3F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H24Cl2FN3O3/c1-20(2,3)29-19(27)25-8-6-15(7-9-25)28-18-16(22)12-26(24-18)11-13-4-5-14(21)10-17(13)23/h4-5,10,12,15H,6-9,11H2,1-3H3 |
| InChIKey | OWRBXUFMOFMJMF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate (CID 163853893) is tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(Oc2nn(Cc3ccc(Cl)cc3F)cc2Cl)CC1.
What is the InChIKey of tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate?
The InChIKey is OWRBXUFMOFMJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24Cl2FN3O3/c1-20(2,3)29-19(27)25-8-6-15(7-9-25)28-18-16(22)12-26(24-18)11-13-4-5-14(21)10-17(13)23/h4-5,10,12,15H,6-9,11H2,1-3H3.
What are the key properties of tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate?
tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate has a molecular weight of 444.33 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-chloro-1-[(4-chloro-2-fluorophenyl)methyl]pyrazol-3-yl]oxypiperidine-1-carboxylate is sourced from PubChem (CID 163853893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).