About 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine
1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine (PubChem CID 163854230) has the molecular formula C7H11N2O-
and a molecular weight of 139.18 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine |
| PubChem CID | 163854230 |
| Molecular Formula | C7H11N2O- |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine |
| SMILES | CNN([O-])C1=CCCC=C1 |
| InChI | InChI=1S/C7H11N2O/c1-8-9(10)7-5-3-2-4-6-7/h3,5-6,8H,2,4H2,1H3/q-1 |
| InChIKey | CPRURANABXTTTP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine (CID 163854230) is 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine is CNN([O-])C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine?
The InChIKey is CPRURANABXTTTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2O/c1-8-9(10)7-5-3-2-4-6-7/h3,5-6,8H,2,4H2,1H3/q-1.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine?
1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine has a molecular weight of 139.18 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-2-methyl-1-oxidohydrazine is sourced from PubChem (CID 163854230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).