C13H29N — CID 163855616
(3R)-N-tert-butyl-4,4,5-trimethylhexan-3-amine (PubChem CID 163855616) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is (3R)-N-tert-butyl-4,4,5-trimethylhexan-3-amine.
| Compound Name | (3R)-N-tert-butyl-4,4,5-trimethylhexan-3-amine |
|---|---|
| PubChem CID | 163855616 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | (3R)-N-tert-butyl-4,4,5-trimethylhexan-3-amine |
| SMILES | CC[C@@H](NC(C)(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C13H29N/c1-9-11(14-12(4,5)6)13(7,8)10(2)3/h10-11,14H,9H2,1-8H3/t11-/m1/s1 |
| InChIKey | OYACCRNLEOBVAC-LLVKDONJSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |