About 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline
4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline (PubChem CID 163856061) has the molecular formula C10H9BrFN
and a molecular weight of 242.09 g/mol. Its IUPAC name is 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline.
Molecular Properties
| Compound Name | 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline |
| PubChem CID | 163856061 |
| Molecular Formula | C10H9BrFN |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline |
| SMILES | CC1NC=c2ccc(F)cc2=C1Br |
| InChI | InChI=1S/C10H9BrFN/c1-6-10(11)9-4-8(12)3-2-7(9)5-13-6/h2-6,13H,1H3 |
| InChIKey | OYKDRPXBKVVQAS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline?
The IUPAC name of 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline (CID 163856061) is 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline.
What is the SMILES notation for 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline?
The canonical SMILES for 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline is CC1NC=c2ccc(F)cc2=C1Br.
What is the InChIKey of 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline?
The InChIKey is OYKDRPXBKVVQAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrFN/c1-6-10(11)9-4-8(12)3-2-7(9)5-13-6/h2-6,13H,1H3.
What are the key properties of 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline?
4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline has a molecular weight of 242.09 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluoro-3-methyl-2,3-dihydroisoquinoline is sourced from PubChem (CID 163856061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).