C51H38N6O3 — CID 163856359
2-[4-[3,5-bis[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylcyclohexa-2,4-dien-1-yl)-1,3,4-oxadiazole (PubChem CID 163856359) has the molecular formula C51H38N6O3 and a molecular weight of 782.90 g/mol. Its IUPAC name is 2-[4-[3,5-bis[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylcyclohexa-2,4-dien-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[3,5-bis[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylcyclohexa-2,4-dien-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163856359 |
| Molecular Formula | C51H38N6O3 |
| Molecular Weight | 782.90 g/mol |
| Exact Mass | 782.30 |
| IUPAC Name | 2-[4-[3,5-bis[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylcyclohexa-2,4-dien-1-yl)-1,3,4-oxadiazole |
| SMILES | CC1=CCC(c2nnc(-c3ccc(-c4cc(-c5ccc(-c6nnc(-c7ccc(C)cc7)o6)cc5)cc(-c5ccc(-c6nnc(-c7ccc(C)cc7)o6)cc5)c4)cc3)o2)C=C1 |
| InChI | InChI=1S/C51H38N6O3/c1-31-4-10-37(11-5-31)46-52-55-49(58-46)40-22-16-34(17-23-40)43-28-44(35-18-24-41(25-19-35)50-56-53-47(59-50)38-12-6-32(2)7-13-38)30-45(29-43)36-20-26-42(27-21-36)51-57-54-48(60-51)39-14-8-33(3)9-15-39/h4-14,16-30,39H,15H2,1-3H3 |
| InChIKey | OYQHMKMHEAQQHU-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.90 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |