C20H19FN5OPS — CID 163856807
4-(5-amino-2-methylphenyl)-8-(2-fluoro-6-phosphanylphenyl)-2-methylsulfanyl-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one (PubChem CID 163856807) has the molecular formula C20H19FN5OPS and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-(5-amino-2-methylphenyl)-8-(2-fluoro-6-phosphanylphenyl)-2-methylsulfanyl-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 4-(5-amino-2-methylphenyl)-8-(2-fluoro-6-phosphanylphenyl)-2-methylsulfanyl-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 163856807 |
| Molecular Formula | C20H19FN5OPS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(5-amino-2-methylphenyl)-8-(2-fluoro-6-phosphanylphenyl)-2-methylsulfanyl-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
| SMILES | CSc1nc(-c2cc(N)ccc2C)c2c(n1)N(c1c(F)cccc1P)C(=O)NC2 |
| InChI | InChI=1S/C20H19FN5OPS/c1-10-6-7-11(22)8-12(10)16-13-9-23-20(27)26(18(13)25-19(24-16)29-2)17-14(21)4-3-5-15(17)28/h3-8H,9,22,28H2,1-2H3,(H,23,27) |
| InChIKey | OYZQXOGDQCYGHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|