C15H13ClN2O3S — CID 163856981
4-amino-6-(4-chloro-3-methoxy-2-sulfanylphenyl)-3-ethenylpyridine-2-carboxylic acid (PubChem CID 163856981) has the molecular formula C15H13ClN2O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is 4-amino-6-(4-chloro-3-methoxy-2-sulfanylphenyl)-3-ethenylpyridine-2-carboxylic acid.
| Compound Name | 4-amino-6-(4-chloro-3-methoxy-2-sulfanylphenyl)-3-ethenylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 163856981 |
| Molecular Formula | C15H13ClN2O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 4-amino-6-(4-chloro-3-methoxy-2-sulfanylphenyl)-3-ethenylpyridine-2-carboxylic acid |
| SMILES | C=Cc1c(N)cc(-c2ccc(Cl)c(OC)c2S)nc1C(=O)O |
| InChI | InChI=1S/C15H13ClN2O3S/c1-3-7-10(17)6-11(18-12(7)15(19)20)8-4-5-9(16)13(21-2)14(8)22/h3-6,22H,1H2,2H3,(H2,17,18)(H,19,20) |
| InChIKey | OZDJNZRHELDRGL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|