C24H33N3O4 — CID 163857133
ethyl (E)-3-[8-[2-[4-(ethylamino)piperidin-1-yl]-1-hydroxyethyl]-2-methoxyquinolin-5-yl]prop-2-enoate (PubChem CID 163857133) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl (E)-3-[8-[2-[4-(ethylamino)piperidin-1-yl]-1-hydroxyethyl]-2-methoxyquinolin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[8-[2-[4-(ethylamino)piperidin-1-yl]-1-hydroxyethyl]-2-methoxyquinolin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163857133 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | ethyl (E)-3-[8-[2-[4-(ethylamino)piperidin-1-yl]-1-hydroxyethyl]-2-methoxyquinolin-5-yl]prop-2-enoate |
| SMILES | CCNC1CCN(CC(O)c2ccc(/C=C/C(=O)OCC)c3ccc(OC)nc23)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-4-25-18-12-14-27(15-13-18)16-21(28)20-8-6-17(7-11-23(29)31-5-2)19-9-10-22(30-3)26-24(19)20/h6-11,18,21,25,28H,4-5,12-16H2,1-3H3/b11-7+ |
| InChIKey | OZGLGYBSIBXVCJ-YRNVUSSQSA-N |
| XLogP | 2.93 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|