About 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one
8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one (PubChem CID 163857285) has the molecular formula C20H15F3O3
and a molecular weight of 360.33 g/mol. Its IUPAC name is 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one.
Molecular Properties
| Compound Name | 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one |
| PubChem CID | 163857285 |
| Molecular Formula | C20H15F3O3 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one |
| SMILES | COc1ccc2c(c1)C(C)(C)c1oc3cc(C(F)(F)F)ccc3c1C2=O |
| InChI | InChI=1S/C20H15F3O3/c1-19(2)14-9-11(25-3)5-7-12(14)17(24)16-13-6-4-10(20(21,22)23)8-15(13)26-18(16)19/h4-9H,1-3H3 |
| InChIKey | OZJVZQLBXBCDKH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one?
The IUPAC name of 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one (CID 163857285) is 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one.
What is the SMILES notation for 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one?
The canonical SMILES for 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one is COc1ccc2c(c1)C(C)(C)c1oc3cc(C(F)(F)F)ccc3c1C2=O.
What is the InChIKey of 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one?
The InChIKey is OZJVZQLBXBCDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3O3/c1-19(2)14-9-11(25-3)5-7-12(14)17(24)16-13-6-4-10(20(21,22)23)8-15(13)26-18(16)19/h4-9H,1-3H3.
What are the key properties of 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one?
8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one has a molecular weight of 360.33 g/mol, XLogP of 5.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-6,6-dimethyl-3-(trifluoromethyl)naphtho[3,2-b][1]benzofuran-11-one is sourced from PubChem (CID 163857285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).