C20H21BrN5- — CID 163858199
[(aminodiazenyl)-[9-[(4-bromocyclohexyl)methyl]carbazol-3-yl]methylidene]azanide (PubChem CID 163858199) has the molecular formula C20H21BrN5- and a molecular weight of 411.33 g/mol. Its IUPAC name is [(aminodiazenyl)-[9-[(4-bromocyclohexyl)methyl]carbazol-3-yl]methylidene]azanide.
| Compound Name | [(aminodiazenyl)-[9-[(4-bromocyclohexyl)methyl]carbazol-3-yl]methylidene]azanide |
|---|---|
| PubChem CID | 163858199 |
| Molecular Formula | C20H21BrN5- |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [(aminodiazenyl)-[9-[(4-bromocyclohexyl)methyl]carbazol-3-yl]methylidene]azanide |
| SMILES | [N-]=C(/N=N/N)c1ccc2c(c1)c1ccccc1n2CC1CCC(Br)CC1 |
| InChI | InChI=1S/C20H21BrN5/c21-15-8-5-13(6-9-15)12-26-18-4-2-1-3-16(18)17-11-14(7-10-19(17)26)20(22)24-25-23/h1-4,7,10-11,13,15H,5-6,8-9,12H2,(H2-,22,23,24)/q-1 |
| InChIKey | PAEYWPHDDJGLOP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|