C21H23ClN8 — CID 163858440
4-(chloromethyl)-N'-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyldiazenyl]benzenecarboximidamide (PubChem CID 163858440) has the molecular formula C21H23ClN8 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-(chloromethyl)-N'-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyldiazenyl]benzenecarboximidamide.
| Compound Name | 4-(chloromethyl)-N'-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyldiazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 163858440 |
| Molecular Formula | C21H23ClN8 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-(chloromethyl)-N'-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyldiazenyl]benzenecarboximidamide |
| SMILES | CC(C)(C)Cn1c(C/N=N/N=C(N)c2ccc(CCl)cc2)cc2cnc(C#N)nc21 |
| InChI | InChI=1S/C21H23ClN8/c1-21(2,3)13-30-17(8-16-11-25-18(10-23)27-20(16)30)12-26-29-28-19(24)15-6-4-14(9-22)5-7-15/h4-8,11H,9,12-13H2,1-3H3,(H2,24,26,28) |
| InChIKey | PAKPEUHNHWITNS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|