C15H16N2O2 — CID 163858863
(6aS)-2-methoxy-8,11-dimethylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-ol (PubChem CID 163858863) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is (6aS)-2-methoxy-8,11-dimethylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-ol.
| Compound Name | (6aS)-2-methoxy-8,11-dimethylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-ol |
|---|---|
| PubChem CID | 163858863 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (6aS)-2-methoxy-8,11-dimethylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-ol |
| SMILES | C=C1C[C@H]2C=Nc3cc(O)c(OC)cc3C(=C)N2C1 |
| InChI | InChI=1S/C15H16N2O2/c1-9-4-11-7-16-13-6-14(18)15(19-3)5-12(13)10(2)17(11)8-9/h5-7,11,18H,1-2,4,8H2,3H3/t11-/m0/s1 |
| InChIKey | PATCLWKOLPKECU-NSHDSACASA-N |
| XLogP | 2.72 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|