C23H26F2N3O8PS — CID 163859272
propan-2-yl (2S)-2-[[[(2S,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163859272) has the molecular formula C23H26F2N3O8PS and a molecular weight of 573.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163859272 |
| Molecular Formula | C23H26F2N3O8PS |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#CC1(F)C(O)[C@@](F)(COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(=S)[nH]c1=O |
| InChI | InChI=1S/C23H26F2N3O8PS/c1-5-22(24)19(30)23(25,35-20(22)28-12-11-17(38)26-21(28)31)13-33-37(32,36-16-9-7-6-8-10-16)27-15(4)18(29)34-14(2)3/h1,6-12,14-15,19-20,30H,13H2,2-4H3,(H,27,32)(H,26,31,38)/t15-,19?,20+,22?,23+,37?/m0/s1 |
| InChIKey | PBBOBIWWNFYGFU-PWCVRQABSA-N |
| XLogP | 2.94 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|