C13H15F2NO2 — CID 163859480
(8aS)-4-(3,5-difluorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ol (PubChem CID 163859480) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is (8aS)-4-(3,5-difluorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ol.
| Compound Name | (8aS)-4-(3,5-difluorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ol |
|---|---|
| PubChem CID | 163859480 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (8aS)-4-(3,5-difluorophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ol |
| SMILES | OC1OC[C@@H]2CCCN2C1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H15F2NO2/c14-9-4-8(5-10(15)6-9)12-13(17)18-7-11-2-1-3-16(11)12/h4-6,11-13,17H,1-3,7H2/t11-,12?,13?/m0/s1 |
| InChIKey | PBFGFZSVDDQHFG-HIFPTAJRSA-N |
| XLogP | 1.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |