About [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene
[chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene (PubChem CID 163860196) has the molecular formula C12H12ClO3P
and a molecular weight of 270.65 g/mol. Its IUPAC name is [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene.
Molecular Properties
| Compound Name | [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene |
| PubChem CID | 163860196 |
| Molecular Formula | C12H12ClO3P |
| Molecular Weight | 270.65 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene |
| SMILES | O=P(Cl)(Oc1ccccc1)OC1C=CC=CC1 |
| InChI | InChI=1S/C12H12ClO3P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-9,12H,10H2 |
| InChIKey | PBVHFLNOPHXNNK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene?
The IUPAC name of [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene (CID 163860196) is [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene.
What is the SMILES notation for [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene?
The canonical SMILES for [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene is O=P(Cl)(Oc1ccccc1)OC1C=CC=CC1.
What is the InChIKey of [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene?
The InChIKey is PBVHFLNOPHXNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClO3P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-9,12H,10H2.
What are the key properties of [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene?
[chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene has a molecular weight of 270.65 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(cyclohexa-2,4-dien-1-yloxy)phosphoryl]oxybenzene is sourced from PubChem (CID 163860196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).