C28H34N4O6 — CID 163860399
N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)pentan-2-yl]-3-(4-methoxy-1H-indole-2-carbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 163860399) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)pentan-2-yl]-3-(4-methoxy-1H-indole-2-carbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)pentan-2-yl]-3-(4-methoxy-1H-indole-2-carbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 163860399 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)pentan-2-yl]-3-(4-methoxy-1H-indole-2-carbonyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4C(C3C(=O)NC(CC3CCCNC3=O)C(=O)C(C)=O)C4(C)C)cc12 |
| InChI | InChI=1S/C28H34N4O6/c1-14(33)24(34)19(11-15-7-6-10-29-25(15)35)31-26(36)23-22-17(28(22,2)3)13-32(23)27(37)20-12-16-18(30-20)8-5-9-21(16)38-4/h5,8-9,12,15,17,19,22-23,30H,6-7,10-11,13H2,1-4H3,(H,29,35)(H,31,36) |
| InChIKey | STSWYQQLSQGHHL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|