C6H5N3O3 — CID 163861571
4,4a-dihydro-3H-2,1,3,4-benzoxatriazine-5,6-dione (PubChem CID 163861571) has the molecular formula C6H5N3O3 and a molecular weight of 167.12 g/mol. Its IUPAC name is 4,4a-dihydro-3H-2,1,3,4-benzoxatriazine-5,6-dione.
| Compound Name | 4,4a-dihydro-3H-2,1,3,4-benzoxatriazine-5,6-dione |
|---|---|
| PubChem CID | 163861571 |
| Molecular Formula | C6H5N3O3 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 4,4a-dihydro-3H-2,1,3,4-benzoxatriazine-5,6-dione |
| SMILES | O=C1C=CC2=NONNC2C1=O |
| InChI | InChI=1S/C6H5N3O3/c10-4-2-1-3-5(6(4)11)7-9-12-8-3/h1-2,5,7,9H |
| InChIKey | HAKKWQWCQWHPCM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|