C18H32N2O7Si — CID 163862001
1-[(2R,3R,4R)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163862001) has the molecular formula C18H32N2O7Si and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163862001 |
| Molecular Formula | C18H32N2O7Si |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[(2R,3R,4R)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCO[C@@H]1[C@H](O)C(CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H32N2O7Si/c1-11(2)18(3,4)28(5,6)26-10-25-15-14(23)12(9-21)27-16(15)20-8-7-13(22)19-17(20)24/h7-8,11-12,14-16,21,23H,9-10H2,1-6H3,(H,19,22,24)/t12?,14-,15-,16-/m1/s1 |
| InChIKey | PDJDJUZPVNJZLN-QQWOZPKZSA-N |
| XLogP | 0.79 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|