C44H31N3O — CID 163862024
5-[4-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-9,9-dimethylxanthene-2-carbonitrile (PubChem CID 163862024) has the molecular formula C44H31N3O and a molecular weight of 617.75 g/mol. Its IUPAC name is 5-[4-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-9,9-dimethylxanthene-2-carbonitrile.
| Compound Name | 5-[4-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-9,9-dimethylxanthene-2-carbonitrile |
|---|---|
| PubChem CID | 163862024 |
| Molecular Formula | C44H31N3O |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 5-[4-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-9,9-dimethylxanthene-2-carbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2Oc2c(-c3ccc(-c4ccccc4-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cccc21 |
| InChI | InChI=1S/C44H31N3O/c1-44(2)37-19-11-18-35(42(37)48-41-25-20-29(28-45)26-38(41)44)31-23-21-30(22-24-31)34-16-9-10-17-36(34)40-27-39(32-12-5-3-6-13-32)46-43(47-40)33-14-7-4-8-15-33/h3-27H,1-2H3 |
| InChIKey | PDJONPOAJGKDMO-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |