C39H43ClFN5O4 — CID 163862028
3-[4-[4-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione (PubChem CID 163862028) has the molecular formula C39H43ClFN5O4 and a molecular weight of 700.26 g/mol. Its IUPAC name is 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163862028 |
| Molecular Formula | C39H43ClFN5O4 |
| Molecular Weight | 700.26 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3ccccc23)cc(Cl)c1CN1CCC(C2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C39H43ClFN5O4/c1-44-22-30(28-5-3-4-6-29(28)39(44)49)26-19-32(40)31(36(20-26)50-2)23-45-15-11-24(12-16-45)25-13-17-46(18-14-25)35-9-7-27(21-33(35)41)42-34-8-10-37(47)43-38(34)48/h3-7,9,19-22,24-25,34,42H,8,10-18,23H2,1-2H3,(H,43,47,48) |
| InChIKey | PDJQBAHXAOJHMK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.26 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|