C37H37N3O5S — CID 163862071
3-[(4Z)-5-oxo-1-phenyl-4-[[5-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)thiophen-2-yl]methylidene]pyrazol-3-yl]butanoic acid (PubChem CID 163862071) has the molecular formula C37H37N3O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is 3-[(4Z)-5-oxo-1-phenyl-4-[[5-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)thiophen-2-yl]methylidene]pyrazol-3-yl]butanoic acid.
| Compound Name | 3-[(4Z)-5-oxo-1-phenyl-4-[[5-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)thiophen-2-yl]methylidene]pyrazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 163862071 |
| Molecular Formula | C37H37N3O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 3-[(4Z)-5-oxo-1-phenyl-4-[[5-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)thiophen-2-yl]methylidene]pyrazol-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2cc3cc4c5c(c3oc2=O)C(C)(C)CCN5CCC4(C)C)s1 |
| InChI | InChI=1S/C37H37N3O5S/c1-21(17-29(41)42)31-26(34(43)40(38-31)23-9-7-6-8-10-23)20-24-11-12-28(46-24)25-18-22-19-27-32-30(33(22)45-35(25)44)37(4,5)14-16-39(32)15-13-36(27,2)3/h6-12,18-21H,13-17H2,1-5H3,(H,41,42)/b26-20- |
| InChIKey | PDKSBEZAUYKQAO-QOMWVZHYSA-N |
| XLogP | 7.59 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|