About 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine
1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine (PubChem CID 163862198) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine.
Molecular Properties
| Compound Name | 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine |
| PubChem CID | 163862198 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine |
| SMILES | CC1C=CC(/N=C(\N)NC#N)=CC1 |
| InChI | InChI=1S/C9H12N4/c1-7-2-4-8(5-3-7)13-9(11)12-6-10/h2,4-5,7H,3H2,1H3,(H3,11,12,13) |
| InChIKey | PDNHRADLTUJAFL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine?
The IUPAC name of 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine (CID 163862198) is 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine.
What is the SMILES notation for 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine?
The canonical SMILES for 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine is CC1C=CC(/N=C(\N)NC#N)=CC1.
What is the InChIKey of 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine?
The InChIKey is PDNHRADLTUJAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-7-2-4-8(5-3-7)13-9(11)12-6-10/h2,4-5,7H,3H2,1H3,(H3,11,12,13).
What are the key properties of 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine?
1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine has a molecular weight of 176.22 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-(4-methylcyclohexa-1,5-dien-1-yl)guanidine is sourced from PubChem (CID 163862198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).