About 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane
1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane (PubChem CID 163862251) has the molecular formula C21H43N7
and a molecular weight of 393.62 g/mol. Its IUPAC name is 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane.
Molecular Properties
| Compound Name | 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane |
| PubChem CID | 163862251 |
| Molecular Formula | C21H43N7 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane |
| SMILES | C.C.CC=CCCc1cn(C(C)CC)nn1.CCC(C)n1cc(CNC)nn1 |
| InChI | InChI=1S/C11H19N3.C8H16N4.2CH4/c1-4-6-7-8-11-9-14(13-12-11)10(3)5-2;1-4-7(2)12-6-8(5-9-3)10-11-12;;/h4,6,9-10H,5,7-8H2,1-3H3;6-7,9H,4-5H2,1-3H3;2*1H4 |
| InChIKey | PDOPLPJAPLZFHS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane?
The IUPAC name of 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane (CID 163862251) is 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane.
What is the SMILES notation for 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane?
The canonical SMILES for 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane is C.C.CC=CCCc1cn(C(C)CC)nn1.CCC(C)n1cc(CNC)nn1.
What is the InChIKey of 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane?
The InChIKey is PDOPLPJAPLZFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3.C8H16N4.2CH4/c1-4-6-7-8-11-9-14(13-12-11)10(3)5-2;1-4-7(2)12-6-8(5-9-3)10-11-12;;/h4,6,9-10H,5,7-8H2,1-3H3;6-7,9H,4-5H2,1-3H3;2*1H4.
What are the key properties of 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane?
1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane has a molecular weight of 393.62 g/mol, XLogP of 5.00, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-pent-3-enyltriazole;1-(1-butan-2-yltriazol-4-yl)-N-methylmethanamine;methane is sourced from PubChem (CID 163862251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).