C27H22BN3O3 — CID 163862354
CID 163862354 (PubChem CID 163862354) has the molecular formula C27H22BN3O3 and a molecular weight of 447.30 g/mol.
| Compound Name | CID 163862354 |
|---|---|
| PubChem CID | 163862354 |
| Molecular Formula | C27H22BN3O3 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1n(C)c(=O)n2-c1ccc(OCc2ccccc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C27H22BN3O3/c1-30-25-21(28)13-8-14-22(25)31(27(30)32)23-15-16-24(33-17-19-9-4-2-5-10-19)29-26(23)34-18-20-11-6-3-7-12-20/h2-16H,17-18H2,1H3 |
| InChIKey | CEQVSPKSLRMCLM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|