About (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine
(4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine (PubChem CID 163864428) has the molecular formula C12H18F2N2
and a molecular weight of 228.29 g/mol. Its IUPAC name is (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine.
Molecular Properties
| Compound Name | (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine |
| PubChem CID | 163864428 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine |
| SMILES | CN1CCC(C(N)C2=CC=C(F)CC2F)C1 |
| InChI | InChI=1S/C12H18F2N2/c1-16-5-4-8(7-16)12(15)10-3-2-9(13)6-11(10)14/h2-3,8,11-12H,4-7,15H2,1H3 |
| InChIKey | PFJXVFICCHEDOB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine?
The IUPAC name of (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine (CID 163864428) is (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine.
What is the SMILES notation for (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine?
The canonical SMILES for (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine is CN1CCC(C(N)C2=CC=C(F)CC2F)C1.
What is the InChIKey of (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine?
The InChIKey is PFJXVFICCHEDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2/c1-16-5-4-8(7-16)12(15)10-3-2-9(13)6-11(10)14/h2-3,8,11-12H,4-7,15H2,1H3.
What are the key properties of (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine?
(4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine has a molecular weight of 228.29 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-difluorocyclohexa-1,3-dien-1-yl)-(1-methylpyrrolidin-3-yl)methanamine is sourced from PubChem (CID 163864428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).