C27H29F2N3O3S — CID 163864706
4-[1-(3-cyclohepta-1,4,6-trien-1-yl-4,5-difluorophenyl)ethyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine (PubChem CID 163864706) has the molecular formula C27H29F2N3O3S and a molecular weight of 513.61 g/mol. Its IUPAC name is 4-[1-(3-cyclohepta-1,4,6-trien-1-yl-4,5-difluorophenyl)ethyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine.
| Compound Name | 4-[1-(3-cyclohepta-1,4,6-trien-1-yl-4,5-difluorophenyl)ethyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine |
|---|---|
| PubChem CID | 163864706 |
| Molecular Formula | C27H29F2N3O3S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 4-[1-(3-cyclohepta-1,4,6-trien-1-yl-4,5-difluorophenyl)ethyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine |
| SMILES | CC(c1cc(F)c(F)c(C2=CCC=CC=C2)c1)N1CCN(C(=O)c2ccc(NS(=O)O)cc2)C(C)C1 |
| InChI | InChI=1S/C27H29F2N3O3S/c1-18-17-31(13-14-32(18)27(33)21-9-11-23(12-10-21)30-36(34)35)19(2)22-15-24(26(29)25(28)16-22)20-7-5-3-4-6-8-20/h3-5,7-12,15-16,18-19,30H,6,13-14,17H2,1-2H3,(H,34,35) |
| InChIKey | KGQLYZMJQNRNAK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|