About 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one
4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one (PubChem CID 163864971) has the molecular formula C10H20N4O
and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one.
Molecular Properties
| Compound Name | 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one |
| PubChem CID | 163864971 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one |
| SMILES | CN1CCNCCN2CCN(CC1)C2=O |
| InChI | InChI=1S/C10H20N4O/c1-12-4-2-11-3-5-13-8-9-14(7-6-12)10(13)15/h11H,2-9H2,1H3 |
| InChIKey | PFVZWAQLDRTFMR-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one?
The IUPAC name of 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one (CID 163864971) is 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one.
What is the SMILES notation for 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one?
The canonical SMILES for 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one is CN1CCNCCN2CCN(CC1)C2=O.
What is the InChIKey of 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one?
The InChIKey is PFVZWAQLDRTFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O/c1-12-4-2-11-3-5-13-8-9-14(7-6-12)10(13)15/h11H,2-9H2,1H3.
What are the key properties of 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one?
4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one has a molecular weight of 212.30 g/mol, XLogP of -0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4,7,10-tetrazabicyclo[8.2.1]tridecan-13-one is sourced from PubChem (CID 163864971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).