About CID 163865661
CID 163865661 (PubChem CID 163865661) has the molecular formula C15H10IO5-
and a molecular weight of 397.14 g/mol.
Molecular Properties
| Compound Name | CID 163865661 |
| PubChem CID | 163865661 |
| Molecular Formula | C15H10IO5- |
| Molecular Weight | 397.14 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | — |
| SMILES | Oc1ccc2c(c1)OCC1c3cc4c(cc3OC21)O[I-]O4 |
| InChI | InChI=1S/C15H10IO5/c17-7-1-2-8-11(3-7)18-6-10-9-4-13-14(21-16-20-13)5-12(9)19-15(8)10/h1-5,10,15,17H,6H2/q-1 |
| InChIKey | LMUORWMQJSQKNG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163865661 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163865661?
The IUPAC name of CID 163865661 (CID 163865661) is not available.
What is the SMILES notation for CID 163865661?
The canonical SMILES for CID 163865661 is Oc1ccc2c(c1)OCC1c3cc4c(cc3OC21)O[I-]O4.
What is the InChIKey of CID 163865661?
The InChIKey is LMUORWMQJSQKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10IO5/c17-7-1-2-8-11(3-7)18-6-10-9-4-13-14(21-16-20-13)5-12(9)19-15(8)10/h1-5,10,15,17H,6H2/q-1.
What are the key properties of CID 163865661?
CID 163865661 has a molecular weight of 397.14 g/mol, XLogP of -0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163865661 is sourced from PubChem (CID 163865661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).