C24H37FN2O3 — CID 163866690
(Z,2R)-7-fluoro-2-methyl-5-[(3R)-5-[(3R)-6-(6-methylcyclohexa-1,3-dien-1-yl)heptan-3-yl]-2,3-dihydro-1,2,4-oxadiazol-3-yl]hept-3-enoic acid (PubChem CID 163866690) has the molecular formula C24H37FN2O3 and a molecular weight of 420.57 g/mol. Its IUPAC name is (Z,2R)-7-fluoro-2-methyl-5-[(3R)-5-[(3R)-6-(6-methylcyclohexa-1,3-dien-1-yl)heptan-3-yl]-2,3-dihydro-1,2,4-oxadiazol-3-yl]hept-3-enoic acid.
| Compound Name | (Z,2R)-7-fluoro-2-methyl-5-[(3R)-5-[(3R)-6-(6-methylcyclohexa-1,3-dien-1-yl)heptan-3-yl]-2,3-dihydro-1,2,4-oxadiazol-3-yl]hept-3-enoic acid |
|---|---|
| PubChem CID | 163866690 |
| Molecular Formula | C24H37FN2O3 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (Z,2R)-7-fluoro-2-methyl-5-[(3R)-5-[(3R)-6-(6-methylcyclohexa-1,3-dien-1-yl)heptan-3-yl]-2,3-dihydro-1,2,4-oxadiazol-3-yl]hept-3-enoic acid |
| SMILES | CC[C@H](CCC(C)C1=CC=CCC1C)C1=N[C@@H](C(/C=C\[C@@H](C)C(=O)O)CCF)NO1 |
| InChI | InChI=1S/C24H37FN2O3/c1-5-19(12-10-17(3)21-9-7-6-8-16(21)2)23-26-22(27-30-23)20(14-15-25)13-11-18(4)24(28)29/h6-7,9,11,13,16-20,22,27H,5,8,10,12,14-15H2,1-4H3,(H,28,29)/b13-11-/t16?,17?,18-,19-,20?,22-/m1/s1 |
| InChIKey | PHGBOXRIVBSKNL-WPLWNVQUSA-N |
| XLogP | 5.46 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|