About CID 163867166
CID 163867166 (PubChem CID 163867166) has the molecular formula C15H9AlN2
and a molecular weight of 244.23 g/mol.
Molecular Properties
| Compound Name | CID 163867166 |
| PubChem CID | 163867166 |
| Molecular Formula | C15H9AlN2 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | — |
| SMILES | [Al]n1c2nc3ccccc3c-2cc2ccccc21 |
| InChI | InChI=1S/C15H9N2.Al/c1-3-7-13-10(5-1)9-12-11-6-2-4-8-14(11)17-15(12)16-13;/h1-9H;/q-1;+1 |
| InChIKey | PMOGCJIXBDCMEO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 163867166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163867166?
The IUPAC name of CID 163867166 (CID 163867166) is not available.
What is the SMILES notation for CID 163867166?
The canonical SMILES for CID 163867166 is [Al]n1c2nc3ccccc3c-2cc2ccccc21.
What is the InChIKey of CID 163867166?
The InChIKey is PMOGCJIXBDCMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N2.Al/c1-3-7-13-10(5-1)9-12-11-6-2-4-8-14(11)17-15(12)16-13;/h1-9H;/q-1;+1.
What are the key properties of CID 163867166?
CID 163867166 has a molecular weight of 244.23 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163867166 is sourced from PubChem (CID 163867166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).