C20H22ClFN3O3S- — CID 163867303
4-[1-(4-chloro-3-fluorophenyl)ethyl]-2-methyl-1-[4-(sulfinatoamino)benzoyl]piperazine (PubChem CID 163867303) has the molecular formula C20H22ClFN3O3S- and a molecular weight of 438.93 g/mol. Its IUPAC name is 4-[1-(4-chloro-3-fluorophenyl)ethyl]-2-methyl-1-[4-(sulfinatoamino)benzoyl]piperazine.
| Compound Name | 4-[1-(4-chloro-3-fluorophenyl)ethyl]-2-methyl-1-[4-(sulfinatoamino)benzoyl]piperazine |
|---|---|
| PubChem CID | 163867303 |
| Molecular Formula | C20H22ClFN3O3S- |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 4-[1-(4-chloro-3-fluorophenyl)ethyl]-2-methyl-1-[4-(sulfinatoamino)benzoyl]piperazine |
| SMILES | CC(c1ccc(Cl)c(F)c1)N1CCN(C(=O)c2ccc(NS(=O)[O-])cc2)C(C)C1 |
| InChI | InChI=1S/C20H23ClFN3O3S/c1-13-12-24(14(2)16-5-8-18(21)19(22)11-16)9-10-25(13)20(26)15-3-6-17(7-4-15)23-29(27)28/h3-8,11,13-14,23H,9-10,12H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | QZDORFKJJVILSL-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|