About 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine
5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine (PubChem CID 163867388) has the molecular formula C16H12BrF3N2O2
and a molecular weight of 401.18 g/mol. Its IUPAC name is 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine.
Molecular Properties
| Compound Name | 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine |
| PubChem CID | 163867388 |
| Molecular Formula | C16H12BrF3N2O2 |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine |
| SMILES | COc1ncc(C#Cc2ccc(C(F)(F)F)cc2CBr)nc1OC |
| InChI | InChI=1S/C16H12BrF3N2O2/c1-23-14-15(24-2)22-13(9-21-14)6-4-10-3-5-12(16(18,19)20)7-11(10)8-17/h3,5,7,9H,8H2,1-2H3 |
| InChIKey | PHURUJCJAJIKTQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine?
The IUPAC name of 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine (CID 163867388) is 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine.
What is the SMILES notation for 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine?
The canonical SMILES for 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine is COc1ncc(C#Cc2ccc(C(F)(F)F)cc2CBr)nc1OC.
What is the InChIKey of 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine?
The InChIKey is PHURUJCJAJIKTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrF3N2O2/c1-23-14-15(24-2)22-13(9-21-14)6-4-10-3-5-12(16(18,19)20)7-11(10)8-17/h3,5,7,9H,8H2,1-2H3.
What are the key properties of 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine?
5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine has a molecular weight of 401.18 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]ethynyl]-2,3-dimethoxypyrazine is sourced from PubChem (CID 163867388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).