About penta-2,3-dien-2-yl N-methylethanimidate
penta-2,3-dien-2-yl N-methylethanimidate (PubChem CID 163867601) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is penta-2,3-dien-2-yl N-methylethanimidate.
Molecular Properties
| Compound Name | penta-2,3-dien-2-yl N-methylethanimidate |
| PubChem CID | 163867601 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | penta-2,3-dien-2-yl N-methylethanimidate |
| SMILES | CC=C=C(C)O/C(C)=N/C |
| InChI | InChI=1S/C8H13NO/c1-5-6-7(2)10-8(3)9-4/h5H,1-4H3/b9-8+ |
| InChIKey | PHZVDOFDJWHKEV-CMDGGOBGSA-N |
| XLogP | 2.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze penta-2,3-dien-2-yl N-methylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-2,3-dien-2-yl N-methylethanimidate?
The IUPAC name of penta-2,3-dien-2-yl N-methylethanimidate (CID 163867601) is penta-2,3-dien-2-yl N-methylethanimidate.
What is the SMILES notation for penta-2,3-dien-2-yl N-methylethanimidate?
The canonical SMILES for penta-2,3-dien-2-yl N-methylethanimidate is CC=C=C(C)O/C(C)=N/C.
What is the InChIKey of penta-2,3-dien-2-yl N-methylethanimidate?
The InChIKey is PHZVDOFDJWHKEV-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H13NO/c1-5-6-7(2)10-8(3)9-4/h5H,1-4H3/b9-8+.
What are the key properties of penta-2,3-dien-2-yl N-methylethanimidate?
penta-2,3-dien-2-yl N-methylethanimidate has a molecular weight of 139.20 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for penta-2,3-dien-2-yl N-methylethanimidate is sourced from PubChem (CID 163867601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).