C25H35ClF2IN5O — CID 163867864
(2S)-N-[1-[1-[(2-chloro-2-iodopropyl)amino]-2-methylpropan-2-yl]imidazol-4-yl]-2-[[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]pentanamide (PubChem CID 163867864) has the molecular formula C25H35ClF2IN5O and a molecular weight of 621.94 g/mol. Its IUPAC name is (2S)-N-[1-[1-[(2-chloro-2-iodopropyl)amino]-2-methylpropan-2-yl]imidazol-4-yl]-2-[[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]pentanamide.
| Compound Name | (2S)-N-[1-[1-[(2-chloro-2-iodopropyl)amino]-2-methylpropan-2-yl]imidazol-4-yl]-2-[[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]pentanamide |
|---|---|
| PubChem CID | 163867864 |
| Molecular Formula | C25H35ClF2IN5O |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | (2S)-N-[1-[1-[(2-chloro-2-iodopropyl)amino]-2-methylpropan-2-yl]imidazol-4-yl]-2-[[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]pentanamide |
| SMILES | CCC[C@H](N[C@H]1CCc2cc(F)cc(F)c2C1)C(=O)Nc1cn(C(C)(C)CNCC(C)(Cl)I)cn1 |
| InChI | InChI=1S/C25H35ClF2IN5O/c1-5-6-21(32-18-8-7-16-9-17(27)10-20(28)19(16)11-18)23(35)33-22-12-34(15-31-22)24(2,3)13-30-14-25(4,26)29/h9-10,12,15,18,21,30,32H,5-8,11,13-14H2,1-4H3,(H,33,35)/t18-,21-,25?/m0/s1 |
| InChIKey | PIFKGDINWSCGCQ-HVACWTNVSA-N |
| XLogP | 5.13 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|