C18H22F2INO — CID 163868029
(2S,4aS,5S,10bS)-9-[difluoro(iodo)methyl]-5-ethenyl-2-propyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 163868029) has the molecular formula C18H22F2INO and a molecular weight of 433.28 g/mol. Its IUPAC name is (2S,4aS,5S,10bS)-9-[difluoro(iodo)methyl]-5-ethenyl-2-propyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2S,4aS,5S,10bS)-9-[difluoro(iodo)methyl]-5-ethenyl-2-propyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 163868029 |
| Molecular Formula | C18H22F2INO |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (2S,4aS,5S,10bS)-9-[difluoro(iodo)methyl]-5-ethenyl-2-propyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | C=C[C@@H]1Nc2ccc(C(F)(F)I)cc2[C@H]2O[C@@H](CCC)CC[C@@H]12 |
| InChI | InChI=1S/C18H22F2INO/c1-3-5-12-7-8-13-15(4-2)22-16-9-6-11(18(19,20)21)10-14(16)17(13)23-12/h4,6,9-10,12-13,15,17,22H,2-3,5,7-8H2,1H3/t12-,13-,15-,17-/m0/s1 |
| InChIKey | PIJBMTUMKMIPAF-HPZZRFSDSA-N |
| XLogP | 5.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|