C17H21N — CID 163868125
(2E,3R)-3-cyclopropyl-2-(2,5,6-trimethylidenecyclohept-3-en-1-ylidene)butan-1-imine (PubChem CID 163868125) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,3R)-3-cyclopropyl-2-(2,5,6-trimethylidenecyclohept-3-en-1-ylidene)butan-1-imine.
| Compound Name | (2E,3R)-3-cyclopropyl-2-(2,5,6-trimethylidenecyclohept-3-en-1-ylidene)butan-1-imine |
|---|---|
| PubChem CID | 163868125 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2E,3R)-3-cyclopropyl-2-(2,5,6-trimethylidenecyclohept-3-en-1-ylidene)butan-1-imine |
| SMILES | [H]/N=C/C(=C1\CC(=C)C(=C)C=CC1=C)[C@H](C)C1CC1 |
| InChI | InChI=1S/C17H21N/c1-11-5-6-12(2)16(9-13(11)3)17(10-18)14(4)15-7-8-15/h5-6,10,14-15,18H,1-3,7-9H2,4H3/b17-16-,18-10+/t14-/m1/s1 |
| InChIKey | PILGJSJCWTURQF-RVFJWGEKSA-N |
| XLogP | 4.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|