C31H24F3NO3 — CID 163868220
N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-prop-2-ynoxybenzamide (PubChem CID 163868220) has the molecular formula C31H24F3NO3 and a molecular weight of 515.53 g/mol. Its IUPAC name is N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-prop-2-ynoxybenzamide.
| Compound Name | N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 163868220 |
| Molecular Formula | C31H24F3NO3 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(C)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C31H24F3NO3/c1-3-12-38-26-8-6-22(7-9-26)31(37)35-25-17-23(14-20-4-10-27(32)19(2)13-20)30(36)24(18-25)15-21-5-11-28(33)29(34)16-21/h1,4-11,13-16,25H,12,17-18H2,2H3,(H,35,37)/b23-14+,24-15+ |
| InChIKey | PINKJUUXSDEBRB-OZEVPFDHSA-N |
| XLogP | 6.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|