C29H29N3O3S — CID 163869415
4-[(E)-2-(3,5-dimethylphenyl)ethenyl]-3-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 163869415) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethylphenyl)ethenyl]-3-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[(E)-2-(3,5-dimethylphenyl)ethenyl]-3-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 163869415 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethylphenyl)ethenyl]-3-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1cc(C)cc(/C=C/c2ccc(C#N)cc2S(=O)(=O)N2CCN(C(=O)c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C29H29N3O3S/c1-21-16-22(2)18-24(17-21)8-10-26-11-9-25(20-30)19-28(26)36(34,35)32-14-12-31(13-15-32)29(33)27-7-5-4-6-23(27)3/h4-11,16-19H,12-15H2,1-3H3/b10-8+ |
| InChIKey | PJMDXNIGNKGNGP-CSKARUKUSA-N |
| XLogP | 4.80 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|