C31H54 — CID 163870154
3,4,4,10,13-pentamethyl-17-(6-methyloct-7-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 163870154) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is 3,4,4,10,13-pentamethyl-17-(6-methyloct-7-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 3,4,4,10,13-pentamethyl-17-(6-methyloct-7-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 163870154 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | 3,4,4,10,13-pentamethyl-17-(6-methyloct-7-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C=CC(C)CCCC(C)C1CCC2C3CCC4C(C)(C)C(C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H54/c1-9-21(2)11-10-12-22(3)25-14-15-26-24-13-16-28-29(5,6)23(4)17-19-31(28,8)27(24)18-20-30(25,26)7/h9,21-28H,1,10-20H2,2-8H3 |
| InChIKey | PKCBJAFPXWCABK-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|