About 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide
8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide (PubChem CID 163870311) has the molecular formula C9H12N2O4S2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide.
Molecular Properties
| Compound Name | 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide |
| PubChem CID | 163870311 |
| Molecular Formula | C9H12N2O4S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide |
| SMILES | CS(=O)(=O)N=C1C=CC=CC=CC1S(N)(=O)=O |
| InChI | InChI=1S/C9H12N2O4S2/c1-16(12,13)11-8-6-4-2-3-5-7-9(8)17(10,14)15/h2-7,9H,1H3,(H2,10,14,15) |
| InChIKey | PKFLCVSEOLMKCQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide?
The IUPAC name of 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide (CID 163870311) is 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide.
What is the SMILES notation for 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide?
The canonical SMILES for 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide is CS(=O)(=O)N=C1C=CC=CC=CC1S(N)(=O)=O.
What is the InChIKey of 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide?
The InChIKey is PKFLCVSEOLMKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S2/c1-16(12,13)11-8-6-4-2-3-5-7-9(8)17(10,14)15/h2-7,9H,1H3,(H2,10,14,15).
What are the key properties of 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide?
8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide has a molecular weight of 276.34 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylsulfonyliminocycloocta-2,4,6-triene-1-sulfonamide is sourced from PubChem (CID 163870311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).