C30H39N3O10 — CID 163870551
2-[[[(4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]heptanoic acid (PubChem CID 163870551) has the molecular formula C30H39N3O10 and a molecular weight of 601.65 g/mol. Its IUPAC name is 2-[[[(4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]heptanoic acid.
| Compound Name | 2-[[[(4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]heptanoic acid |
|---|---|
| PubChem CID | 163870551 |
| Molecular Formula | C30H39N3O10 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 2-[[[(4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]heptanoic acid |
| SMILES | CCCCCC(NCNC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@H]2[C@H](N(C)C)C1=O)C(=O)O |
| InChI | InChI=1S/C30H39N3O10/c1-5-6-7-10-17(28(40)41)31-13-32-27(39)21-24(36)22(33(3)4)16-12-15-20(25(37)30(16,43)26(21)38)23(35)19-14(29(15,2)42)9-8-11-18(19)34/h8-9,11,15-17,22,31,34-35,38,42-43H,5-7,10,12-13H2,1-4H3,(H,32,39)(H,40,41)/t15-,16-,17?,22-,29+,30-/m0/s1 |
| InChIKey | FBZDSYCOAMOBHQ-DVAVLVRXSA-N |
| XLogP | 0.84 |
| TPSA | 216.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|