C33H42F3N7O2 — CID 163870937
2-[(2S)-4-[8-(2,6-difluorophenyl)-2-[[1-[(dimethylamino)methyl]cyclohexyl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile (PubChem CID 163870937) has the molecular formula C33H42F3N7O2 and a molecular weight of 625.74 g/mol. Its IUPAC name is 2-[(2S)-4-[8-(2,6-difluorophenyl)-2-[[1-[(dimethylamino)methyl]cyclohexyl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[8-(2,6-difluorophenyl)-2-[[1-[(dimethylamino)methyl]cyclohexyl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 163870937 |
| Molecular Formula | C33H42F3N7O2 |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 2-[(2S)-4-[8-(2,6-difluorophenyl)-2-[[1-[(dimethylamino)methyl]cyclohexyl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OCC3(CN(C)C)CCCCC3)nc3c2CCCN(c2c(F)cccc2F)C3)C[C@@H]1CC#N |
| InChI | InChI=1S/C33H42F3N7O2/c1-23(34)31(44)43-18-17-42(19-24(43)12-15-37)30-25-9-8-16-41(29-26(35)10-7-11-27(29)36)20-28(25)38-32(39-30)45-22-33(21-40(2)3)13-5-4-6-14-33/h7,10-11,24H,1,4-6,8-9,12-14,16-22H2,2-3H3/t24-/m0/s1 |
| InChIKey | PKSPZAQUSUXEQX-DEOSSOPVSA-N |
| XLogP | 5.01 |
| TPSA | 88.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|